CAS 3067-14-9
:Benzo[a]pyrene-3,6-dione
Description:
Benzo[a]pyrene-3,6-dione is a polycyclic aromatic hydrocarbon derivative characterized by its fused ring structure, which includes a dione functional group at the 3 and 6 positions. This compound is known for its potential mutagenic and carcinogenic properties, as it is a derivative of benzo[a]pyrene, a well-studied environmental pollutant. The presence of the dione functional group enhances its reactivity, making it a subject of interest in studies related to environmental chemistry and toxicology. Benzo[a]pyrene-3,6-dione is typically found in combustion products, such as those from fossil fuels and tobacco smoke, and can also be formed during the metabolic activation of benzo[a]pyrene in biological systems. Its solubility characteristics may vary, influencing its behavior in different environmental matrices. Due to its potential health risks, understanding the properties and behavior of this compound is crucial for assessing exposure risks and developing strategies for environmental remediation.
Formula:C20H10O2
InChI:InChI=1S/C20H10O2/c21-17-10-6-11-5-7-13-12-3-1-2-4-14(12)20(22)16-9-8-15(17)18(11)19(13)16/h1-10H
InChI key:InChIKey=MYRYNZSMCVOJHZ-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C(=CC2)C(=O)C=CC4=CC=C3C=5C1=CC=CC5
Synonyms:- 3,6-Dihydrobenzo[a]pyrene-3,6-dione
- Benzo[A]Pyrene-3,6-Dione
- Benzo[a]pyrene-3,6-quinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzo[a]pyrene-3,6-quinone
CAS:Controlled Product<p>Applications Benzo[a]pyrene-3,6-quinone is a metabolite of Benzopyrene (B205800) and is able to induce epidermal growth factor receptor (EGFR) cell signaling in human mammary epithelial cells. Also highly mutagenic and carcinogenic.<br>References Rodriguez-Fragoso, L., et al.: Toxicol. Appl. Pharm., 235, 321 (2009); Sen, S., et al.: Chem. Res. Toxicol., 25, 2117 (2012)<br></p>Formula:C20H10O2Color and Shape:NeatMolecular weight:282.29

