CAS 30673-60-0
:Propyl decanoate
Description:
Propyl decanoate, with the CAS number 30673-60-0, is an ester formed from the reaction of propanol and decanoic acid. It is characterized by its pleasant fruity odor, making it useful in the flavor and fragrance industries. This compound typically appears as a colorless to pale yellow liquid and is relatively non-toxic, which contributes to its application in food and cosmetic products. Propyl decanoate has a moderate boiling point and is soluble in organic solvents, but it has limited solubility in water due to its hydrophobic nature. Its molecular structure consists of a long hydrophobic carbon chain, which influences its physical properties, such as viscosity and volatility. Additionally, propyl decanoate can be used as a solvent and in the synthesis of other chemical compounds. Its stability under normal conditions makes it a versatile compound in various industrial applications. However, like many esters, it may undergo hydrolysis in the presence of water and acids or bases, leading to the release of the corresponding alcohol and acid.
Formula:C13H26O2
InChI:InChI=1S/C13H26O2/c1-3-5-6-7-8-9-10-11-13(14)15-12-4-2/h3-12H2,1-2H3
InChI key:InChIKey=OVFMRFMJVFDSAA-UHFFFAOYSA-N
SMILES:C(C(OCCC)=O)CCCCCCCC
Synonyms:- Decanoic acid, propyl ester
- Propyl Decanoate
- Propyl caprate
- n-Propyl decanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
n-Propyl decanoate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H26O2Purity:98%Color and Shape:Clear colorless, LiquidMolecular weight:214.35Propyl caprate
CAS:Propyl caprate is a biochemical.Formula:C13H26O2Purity:98%Color and Shape:SolidMolecular weight:214.34




