CAS 30683-38-6

4,5,6,7-tetrafluoroindole-3-carboxaldehyde

Description:

4,5,6,7-Tetrafluoroindole-3-carboxaldehyde is a fluorinated organic compound characterized by the presence of an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of four fluorine atoms significantly influences its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated analogs. The aldehyde functional group at the 3-position of the indole ring makes it a reactive species, capable of participating in various chemical reactions such as nucleophilic additions and condensation reactions. This compound is of interest in medicinal chemistry and materials science due to its potential applications in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of fluorinated materials. Its unique electronic properties, stemming from the fluorine substituents, can also enhance its biological activity and stability. Safety data should be consulted for handling, as fluorinated compounds can exhibit different toxicological profiles compared to their non-fluorinated counterparts.

Formula: C₉H₃F₄NO

InChI: InChI=1/C9H3F4NO/c10-5-4-3(2-15)1-14-9(4)8(13)7(12)6(5)11/h1-2,14H

SMILES: c1c(C=O)c2c(c(c(c(c2[nH]1)F)F)F)F

Synonyms:

• 4,5,6,7-tetrafluoro-1H-indole-3-carbaldehyde

1H-Indole-3-carboxaldehyde, 4,5,6,7-tetrafluoro-

CAS: 30683-38-6

Formula: C₉H₃F₄NO

Purity: %

Molecular weight: 217.1198

Ref: IN-DA0030SN

4,5,6,7-Tetrafluoro-1H-indole-3-carboxaldehyde

CAS: 30683-38-6

4,5,6,7-Tetrafluoro-1H-indole-3-carboxaldehyde

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.12g/mol

Ref: 54-PC6792J

4,5,6,7-Tetrafluoroindole-3-carboxaldehyde

CAS: 30683-38-6

Formula: C₉H₃F₄NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 217.123

Ref: 10-F007365

4,5,6,7-Tetrafluoroindole-3-Carboxaldehyde

CAS: 30683-38-6

4,5,6,7-Tetrafluoroindole-3-Carboxaldehyde is a synthetic compound with inhibitory activity against sulfonyl hydroxamate and tryptophanyl hydroxamate. 4,5,6,7-Tetrafluoroindole-3-Carboxaldehyde inhibits the synthesis of tryptamine and the formation of formyl and alkaloid compounds by inhibiting the enzyme indoleamine 2,3 dioxygenase (IDO). This compound is also able to inhibit the production of tryptophan in bacteria.

Formula: C₉H₃F₄NO

Purity: Min. 95%

Molecular weight: 217.12 g/mol

Ref: 3D-FT86912