CAS 30688-66-5

4,6-O-benzylidene-D-glucopyranose

Description:

4,6-O-benzylidene-D-glucopyranose is a carbohydrate derivative characterized by the presence of a benzylidene group at the 4 and 6 positions of the glucopyranose ring. This compound is typically a white to off-white crystalline solid, exhibiting solubility in organic solvents such as methanol and ethanol, while being less soluble in water due to its hydrophobic benzylidene substituents. The presence of the benzylidene group enhances its stability and can influence its reactivity, making it useful in various organic synthesis applications, particularly in glycoside formation and as a protecting group in carbohydrate chemistry. The compound's structure allows for potential interactions with biological systems, which may be of interest in medicinal chemistry and drug design. Additionally, it may exhibit specific optical activity due to its chiral nature, which is a common characteristic of sugars and their derivatives. Overall, 4,6-O-benzylidene-D-glucopyranose serves as an important intermediate in the synthesis of more complex carbohydrate-based molecules.

Formula: C₁₃H₁₆O₆

InChI: InChI=1/C13H16O6/c14-6-9(15)11(17)12-10(16)7-18-13(19-12)8-4-2-1-3-5-8/h1-6,9-13,15-17H,7H2/t9-,10+,11+,12+,13?/m0/s1

Synonyms:

• D-Glucose, 4,6-O-(phenylmethylene)-
• 4,6-O-(Phenylmethylene)-D-glucose
• 4,6-O-benzylidene-D-glucose

D-​Glucose, 4,​6-​O-​(phenylmethylene)​-

CAS: 30688-66-5

Formula: C₁₃H₁₆O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 268.2625

Ref: IN-DA0030TA

4,6-O-Benzylidene-D-glucose

CAS: 30688-66-5

Ref: 7W-GC2364

4,6-Benzilidine-D-Glucose

CAS: 30688-66-5

4,6-Benzilidine-D-Glucose is a clinical antitumor compound showing antitumor activity in rats with chemically induced hepatocellular carcinoma.

Formula: C₁₃H₁₆O₆

Purity: 99.35%

Color and Shape: Solid

Molecular weight: 268.26

Ref: TM-TN7217

4,6-Benzilidine-D-Glucose

CAS: 30688-66-5

4,6-Benzilidine-D-Glucose

Purity: ≥98%

Molecular weight: 268.26g/mol

Ref: 54-BUP18661

4,6-O-Benzylidene glucose

CAS: 30688-66-5

4,6-O-Benzylidene glucose

Purity: 95%

Color and Shape: Solid

Molecular weight: 268.26g/mol

Ref: 54-OR921543

4,6-O-Benzylidene-D-glucose

CAS: 30688-66-5

4,6-O-Benzylidene-D-glucose is a potent inhibitor of the enzyme dibutyltin oxide, which is involved in the synthesis of energy. It has been shown to have clinical activity in rat cardiomyocytes and has been tested in clinical studies. 4,6-O-Benzylidene-D-glucose inhibits enzymes by forming hydrogen bonds with their substrates. This compound also interacts with hydrochloric acid to form a stable complex that prevents it from interacting with other molecules. 4,6-O-Benzylidene-D-glucose is rapidly broken down into glucose and benzaldehyde when it reacts with carbonyl groups or amines. The asymmetric synthesis of this compound can be achieved using an intramolecular hydrogen transfer reaction.
4,6-O-Benzylidene glucose is derived from D-mannose derivatives and contains a hydroxyl group on the central carbon

Formula: C₁₃H₁₆O₆

Purity: Min. 98 Area-%

Color and Shape: White Powder

Molecular weight: 268.26 g/mol

Ref: 3D-MB03806

4,6-O-Benzylidene-D-glucose

CAS: 30688-66-5

Formula: C₁₃H₁₆O₆

Purity: 95+%

Color and Shape: Solid

Molecular weight: 268.265

Ref: 10-F329792