CAS 306934-94-1
:1-(4-Methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
Description:
1-(4-Methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate to high stability under standard conditions, and it may be sensitive to moisture due to the presence of the carbonyl chloride moiety. The methoxy group can influence its solubility and reactivity, often enhancing lipophilicity. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in synthetic organic chemistry for the formation of amides or esters. Additionally, the presence of the pyrazole ring may impart biological activity, as pyrazole derivatives are known for their diverse pharmacological properties. Overall, this compound is of interest in both synthetic applications and potential medicinal chemistry.
Formula:C12H11ClN2O2
InChI:InChI=1S/C12H11ClN2O2/c1-8-11(12(13)16)7-14-15(8)9-3-5-10(17-2)6-4-9/h3-7H,1-2H3
InChI key:InChIKey=BJGXXQTZIKOIGR-UHFFFAOYSA-N
SMILES:CC=1N(N=CC1C(Cl)=O)C2=CC=C(OC)C=C2
Synonyms:- 1H-Pyrazole-4-carbonyl chloride, 1-(4-methoxyphenyl)-5-methyl-
- 1-(4-Methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(4-Methoxyphenyl)-5-methyl-1h-pyrazole-4-carbonyl chloride
CAS:Formula:C12H11ClN2O2Molecular weight:250.68091-(4-Methoxy-phenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
CAS:Formula:C12H11ClN2O2Color and Shape:SolidMolecular weight:250.681-(4-Methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
CAS:1-(4-Methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride
Molecular weight:250.68g/mol


