CAS 306935-04-6: 5-Methyl-2-(trifluoromethyl)-3-furanmethanol
Description:5-Methyl-2-(trifluoromethyl)-3-furanmethanol is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a methyl group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group (-CH2OH) contributes to its potential as a reactive intermediate in various chemical reactions. Additionally, the compound's structure suggests it may exhibit unique solubility characteristics and reactivity patterns due to the electron-withdrawing nature of the trifluoromethyl group. Its CAS number, 306935-04-6, allows for precise identification in chemical databases and literature. Overall, 5-Methyl-2-(trifluoromethyl)-3-furanmethanol is a compound of interest for further study in organic synthesis and potential applications in pharmaceuticals or agrochemicals.
Formula:C7H7F3O2
InChI:InChI=1S/C7H7F3O2/c1-4-2-5(3-11)6(12-4)7(8,9)10/h2,11H,3H2,1H3
InChI key:InChIKey=LNUBNANARKGWDE-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1OC(=CC1CO)C
- Synonyms:
- 3-Furanmethanol, 5-methyl-2-(trifluoromethyl)-
- 5-Methyl-2-(trifluoromethyl)-3-furanmethanol
- [5-Methyl-2-(Trifluoromethyl)Furan-3-Yl]Methanol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [5-Methyl-2-(trifluoromethyl)-3-furyl]methanol REF: 54-PC31426CAS: 306935-04-6 | - - - | To inquire | Mon 21 Apr 25 |
![]() | (5-Methyl-2-(trifluoromethyl)furan-3-yl)methanol REF: 10-F761819CAS: 306935-04-6 | 98% | - - - | Discontinued product |
![]() | [5-Methyl-2-(Trifluoromethyl)-3-Furyl]Methanol REF: 3D-FM89935CAS: 306935-04-6 | Min. 95% | - - - | Discontinued product |

Ref: 54-PC31426
Undefined size | To inquire |

(5-Methyl-2-(trifluoromethyl)furan-3-yl)methanol
Ref: 10-F761819
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

[5-Methyl-2-(Trifluoromethyl)-3-Furyl]Methanol
Ref: 3D-FM89935
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |