CAS 306935-07-9

[5-Chloro-2-nitro-4-(trifluoromethyl)phenyl]hydrazine

Description:

[5-Chloro-2-nitro-4-(trifluoromethyl)phenyl]hydrazine, with the CAS number 306935-07-9, is an organic compound characterized by its hydrazine functional group attached to a substituted phenyl ring. The presence of a chloro group, a nitro group, and a trifluoromethyl group on the aromatic ring contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the presence of multiple functional groups that can participate in further chemical reactions. Additionally, the trifluoromethyl group is known to enhance lipophilicity and biological activity, making such compounds of interest in medicinal chemistry. However, handling and usage should be approached with caution due to the potential toxicity associated with hydrazine derivatives.

Formula: C₇H₅ClF₃N₃O₂

InChI: InChI=1S/C7H5ClF3N3O2/c8-4-2-5(13-12)6(14(15)16)1-3(4)7(9,10)11/h1-2,13H,12H2

InChI key: InChIKey=QNRHMRNOEVKULO-UHFFFAOYSA-N

SMILES: N(N)C1=C(N(=O)=O)C=C(C(F)(F)F)C(Cl)=C1

Synonyms:

• Hydrazine, [5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-
• [5-Chloro-2-Nitro-4-(Trifluoromethyl)Phenyl]Hydrazine

Hydrazine, [5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-

CAS: 306935-07-9

Formula: C₇H₅ClF₃N₃O₂

Molecular weight: 255.5817

Ref: IN-DA0030TU

5-Chloro-2-nitro-4-(trifluoromethyl)phenylhydrazine

CAS: 306935-07-9

5-Chloro-2-nitro-4-(trifluoromethyl)phenylhydrazine

Molecular weight: 255.58g/mol

Ref: 54-PC6607