CymitQuimica logo

CAS 306935-24-0

:

2,1,3-benzoxadiazole-5-carbothioamide

Description:
2,1,3-Benzoxadiazole-5-carbothioamide is a heterocyclic compound characterized by its benzoxadiazole core, which consists of a fused benzene and diazole ring system. This compound features a carbothioamide functional group at the 5-position, contributing to its potential reactivity and biological activity. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic structure. The presence of the carbothioamide group can enhance the compound's ability to form hydrogen bonds, influencing its interactions in biological systems. Such compounds are often investigated for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their unique electronic properties and ability to participate in various chemical reactions. Additionally, the structural features of 2,1,3-benzoxadiazole derivatives can lead to interesting photophysical properties, making them candidates for use in organic light-emitting diodes (OLEDs) and other optoelectronic devices.
Formula:C7H5N3OS
InChI:InChI=1/C7H5N3OS/c8-7(12)4-1-2-5-6(3-4)10-11-9-5/h1-3H,(H2,8,12)
SMILES:c1cc2c(cc1C(=N)S)non2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.