CAS 306935-95-5

5-[4-(trifluoromethoxy)phenyl]-2-furaldehyde

Description:

5-[4-(Trifluoromethoxy)phenyl]-2-furaldehyde is an organic compound characterized by its distinctive functional groups and structure. It features a furaldehyde moiety, which is a five-membered aromatic ring containing both a carbonyl and an alkene group, contributing to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethoxy group, which consists of a phenyl ring substituted with a trifluoromethoxy (-O-CF3) group, enhances the compound's lipophilicity and may influence its electronic properties, making it useful in various chemical reactions and applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of novel compounds with specific biological activities or physical properties. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₂H₇F₃O₃

InChI: InChI=1/C12H7F3O3/c13-12(14,15)18-9-3-1-8(2-4-9)11-6-5-10(7-16)17-11/h1-7H

SMILES: c1cc(ccc1c1ccc(C=O)o1)OC(F)(F)F

Synonyms:

• 5-[4-(Trifluoromethoxy)Phenyl]Furan-2-Carbaldehyde

5-[4-(Trifluoromethoxy)phenyl]-2-furaldehyde

CAS: 306935-95-5

5-[4-(Trifluoromethoxy)phenyl]-2-furaldehyde

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 256.18g/mol

Ref: 54-PC32291