CAS 306936-11-8

3-amino-4-(ethoxycarbonyl)pyridinium chloride

Description:

3-Amino-4-(ethoxycarbonyl)pyridinium chloride is a chemical compound characterized by its pyridine ring structure, which is substituted at the 3-position with an amino group and at the 4-position with an ethoxycarbonyl group. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the pyridinium cation and the chloride anion. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. The ethoxycarbonyl group introduces an ester functionality, which can be involved in various chemical reactions, such as esterification or nucleophilic substitution. This compound may be of interest in organic synthesis and medicinal chemistry, particularly for its potential biological activities or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₈H₁₁ClN₂O₂

InChI: InChI=1/C8H10N2O2.ClH/c1-2-12-8(11)6-3-4-10-5-7(6)9;/h3-5H,2,9H2,1H3;1H

SMILES: CCOC(=O)c1ccncc1N.Cl

Synonyms:

• 4-Pyridinecarboxylic Acid, 3-Amino-, Ethyl Ester, Hydrochloride (1:1)
• Ethyl 3-Aminoisonicotinate Hydrochloride (1:1)
• Ethyl-3-aminoisonicotinathydrochlorid(1:1)