CAS 306936-46-9: 2-methyl-1-[4-(methylsulfanyl)phenyl]-5-phenyl-1H-pyrrole-3-carboxylic acid
Description:2-Methyl-1-[4-(methylsulfanyl)phenyl]-5-phenyl-1H-pyrrole-3-carboxylic acid is a complex organic compound characterized by its pyrrole core, which is a five-membered aromatic ring containing nitrogen. This compound features multiple functional groups, including a carboxylic acid, which contributes to its acidity and potential for hydrogen bonding. The presence of a methylsulfanyl group introduces a sulfur atom, which can influence the compound's reactivity and solubility. The phenyl groups attached to the pyrrole enhance its aromatic character and may affect its electronic properties, making it potentially useful in various applications, including pharmaceuticals and materials science. The compound's structure suggests it may exhibit interesting biological activity, although specific biological properties would require further investigation. Additionally, its molecular complexity indicates that it may have unique interactions in chemical reactions or biological systems. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various fields.
Formula:C19H17NO2S
InChI:InChI=1/C19H17NO2S/c1-13-17(19(21)22)12-18(14-6-4-3-5-7-14)20(13)15-8-10-16(23-2)11-9-15/h3-12H,1-2H3,(H,21,22)
- Synonyms:
- 1H-pyrrole-3-carboxylic acid, 2-methyl-1-[4-(methylthio)phenyl]-5-phenyl-
- 2-Methyl-1-[4-(Methylthio)Phenyl]-5-Phenyl-1H-Pyrrole-3-Carboxylic Acid
- 2-Methyl-1-[4-(methylsulfanyl)phenyl]-5-phenyl-1H-pyrrole-3-carboxylic acid

1H-Pyrrole-3-carboxylic acid, 2-methyl-1-[4-(methylthio)phenyl]-5-phenyl-
Ref: IN-DA0030XO
Undefined size | To inquire |

1-(4-Methylthiophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid
Ref: 54-OR8137
1g | 152.00 € | ||
5g | 535.00 € | ||
10g | 920.00 € |

2-methyl-1-[4-(methylthio)phenyl]-5-phenyl-1H-pyrrole-3-carboxylic acid
Ref: 10-F518863
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

1-(4-Methylthiophenyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid
Ref: 3D-GMA93646
5g | Discontinued | Request information | |
10g | Discontinued | Request information |