CAS 306936-85-6

4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structural features, which include a triazole ring and a benzodioxin moiety. This compound typically exhibits properties associated with thiones, such as potential reactivity due to the presence of sulfur in the thione functional group. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the benzodioxin structure can contribute to its lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the methyl group on the triazole ring may affect its electronic properties and steric hindrance, which can be crucial for its interaction with biological targets. As with many organic compounds, its stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of heterocyclic compounds that may have diverse applications in research and industry.

Formula: C₁₁H₁₁N₃O₂S

InChI: InChI=1/C11H11N3O2S/c1-7-12-13-11(17)14(7)8-2-3-9-10(6-8)16-5-4-15-9/h2-3,6H,4-5H2,1H3,(H,13,17)

SMILES: Cc1nnc(n1c1ccc2c(c1)OCCO2)S

Synonyms:

• 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-

4-(3,4-Ethylenedioxyphenyl)-5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 306936-85-6

4-(3,4-Ethylenedioxyphenyl)-5-methyl-4H-1,2,4-triazole-3-thiol

Purity: ≥95%

Molecular weight: 249.29g/mol

Ref: 54-OR1520