CymitQuimica logo

CAS 306936-98-1

:

ethyl 3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carboxylate

Description:
Ethyl 3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a tert-butyl group enhances its steric bulk, potentially influencing its biological activity and interactions. Additionally, the 4-fluorobenzyl substituent introduces a fluorine atom, which can affect the compound's electronic properties and lipophilicity. This compound is typically used in medicinal chemistry and may exhibit various pharmacological activities, making it of interest in drug development. Its structural complexity and functional groups suggest potential applications in areas such as agrochemicals or pharmaceuticals. As with many organic compounds, its stability, reactivity, and interactions with biological systems would depend on the specific conditions under which it is studied. Proper handling and safety measures should be observed due to the presence of reactive functional groups.
Formula:C8H7ClFNS
InChI:InChI=1/C8H7ClFNS/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4H,3H2,(H2,11,12)
SMILES:c1cc(cc(c1CC(=N)S)Cl)F
Synonyms:
  • Ethyl 3-(t-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carboxylate
  • 2-(2-Chloro-4-Fluorophenyl)Ethanethioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.