CymitQuimica logo

CAS 306979-64-6

:

3-(3-Fluorophenoxy)-2-butanone

Description:
3-(3-Fluorophenoxy)-2-butanone, identified by its CAS number 306979-64-6, is an organic compound characterized by its unique structure that includes a butanone moiety and a fluorophenoxy group. This compound typically exhibits a moderate polarity due to the presence of both hydrophobic (the butanone and phenyl groups) and hydrophilic (the ether linkage) characteristics. The fluorine atom in the phenoxy group can influence the compound's reactivity and physical properties, such as boiling point and solubility, by altering electron density and steric effects. It may be utilized in various chemical syntheses and could serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the fluorine atom often enhances biological activity and lipophilicity, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C10H11FO2
InChI:InChI=1S/C10H11FO2/c1-7(12)8(2)13-10-5-3-4-9(11)6-10/h3-6,8H,1-2H3
InChI key:InChIKey=ACOKHCOUJBITRG-UHFFFAOYSA-N
SMILES:O(C(C(C)=O)C)C1=CC(F)=CC=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.