CAS 307-49-3
:tetracosafluoroundecane
Description:
Tetracosafluoroundecane, with the CAS number 307-49-3, is a perfluorinated compound characterized by a long carbon chain consisting of 11 carbon atoms, fully fluorinated. This substance is part of the perfluoroalkane family, which is known for its unique properties, including high thermal stability, low surface tension, and resistance to chemical degradation. Tetracosafluoroundecane is typically colorless and odorless, exhibiting low volatility and high hydrophobicity, making it non-wetting to water. Its fluorinated nature imparts exceptional chemical inertness, allowing it to resist reactions with most chemicals, including acids and bases. This compound is often used in specialized applications such as in the production of water- and oil-repellent coatings, as well as in various industrial processes. However, due to environmental concerns associated with perfluorinated compounds, including potential bioaccumulation and persistence in the environment, its use is subject to regulatory scrutiny. Overall, tetracosafluoroundecane exemplifies the unique characteristics of fluorinated hydrocarbons, combining stability with specific functional properties.
Formula:C11F24
InChI:InChI=1/C11F24/c12-1(13,2(14,15)4(18,19)6(22,23)8(26,27)10(30,31)32)3(16,17)5(20,21)7(24,25)9(28,29)11(33,34)35
SMILES:C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- Perfluoroundecane
- Undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Tetracosafluoro-
- Tetracosafluoroundecane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetracosafluoro-
CAS:Formula:C11F24Molecular weight:588.0794Tetracosafluoroundecane
CAS:Controlled ProductTetracosafluoroundecane is a perfluorinated compound that can be used to pattern surfaces. It has a hydroxyl group and fluorine atom, which are important for the polymerization process. Tetracosafluoroundecane can be used as a coating to provide chemical protection against corrosion, abrasion, and heat. The film is also non-sticky and easy to clean. The polymer film has been shown to have no adverse health effects on human serum and caco-2 cells in cell culture studies. The toxicity of tetracosafluoroundecane has been shown to be low in mice with radiation exposure, making it an ideal candidate for diagnostic purposes.
Formula:C11F24Purity:Min. 95%Molecular weight:588.08 g/mol

