CAS 307-59-5
:Perfluorododecane
Description:
Perfluorododecane, with the CAS number 307-59-5, is a perfluorinated compound characterized by a long carbon chain consisting of twelve carbon atoms, each fully saturated with fluorine atoms. This structure imparts unique properties, including exceptional chemical stability and resistance to degradation, making it non-reactive under most conditions. Perfluorododecane is a colorless, odorless liquid at room temperature and exhibits low surface tension and high hydrophobicity, which contributes to its use in various applications, including as a surfactant and in specialty coatings. Its high thermal stability allows it to withstand elevated temperatures without decomposing. Additionally, perfluorododecane is known for its low toxicity to humans and animals, although environmental concerns arise from its persistence and potential bioaccumulation. As a member of the perfluoroalkane family, it is also subject to regulatory scrutiny due to its environmental impact, particularly regarding its long-term effects on ecosystems. Overall, perfluorododecane is notable for its unique physical and chemical properties, making it valuable in specific industrial applications while raising environmental awareness.
Formula:C12F26
InChI:InChI=1/C12F26/c13-1(14,3(17,18)5(21,22)7(25,26)9(29,30)11(33,34)35)2(15,16)4(19,20)6(23,24)8(27,28)10(31,32)12(36,37)38
InChI key:InChIKey=WNZGTRLARPEMIG-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Hexacosafluorododecane
- Dodecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluoro-
- Dodecane, hexacosafluoro-
- Hexacosafluorododecane
- Perfluoro-n-dodecane
- Perfluorododecane
- Perfluoron-dodecane
- Perfluorododecane 97%
- Perfluorododecane97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dodecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluoro-
CAS:Formula:C12F26Purity:99%Color and Shape:SolidMolecular weight:638.0869Perfluorododecane
CAS:PerfluorododecaneFormula:C12F26Purity:97%Color and Shape: solidMolecular weight:638.09g/molHexacosafluorododecane
CAS:Controlled ProductHexacosafluorododecane is a molecule that has been detected in the interstellar medium. The molecule fluoresces when irradiated with light and has a strong absorption band at about 6.6 micrometers, which corresponds to the wavelength of radiation emitted by a chlorine atom. Hexacosafluorododecane is also found in fatty esters and can be created by the reaction of an acylation reaction with hydrochloric acid, sodium hydroxide solution, and fluorine.Formula:C12F26Purity:Min. 95%Molecular weight:638.09 g/mol




