CAS 307-78-8
:hexadecafluorodecanedioic acid
Description:
Hexadecafluorodecanedioic acid, with the CAS number 307-78-8, is a perfluorinated dicarboxylic acid characterized by its fully fluorinated carbon chain. This compound features a linear structure with a total of ten carbon atoms, each of which is fully substituted with fluorine atoms, resulting in a highly hydrophobic and lipophobic nature. The presence of two carboxylic acid functional groups at each end of the carbon chain imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. Hexadecafluorodecanedioic acid is known for its thermal stability and resistance to degradation, making it useful in specialized applications such as surfactants, coatings, and as a potential building block in the synthesis of fluorinated polymers. Its unique properties also raise environmental and health concerns, particularly regarding persistence and bioaccumulation in ecosystems. As with many perfluorinated compounds, regulatory scrutiny is increasing due to potential adverse effects on human health and the environment.
Formula:C10H2F16O4
InChI:InChI=1/C10H2F16O4/c11-3(12,1(27)28)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2(29)30/h(H,27,28)(H,29,30)
SMILES:C(=O)(C(C(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
Synonyms:- Decanedioic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-
- Hexadecafluorodecanedioic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Decanedioic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-
CAS:Formula:C10H2F16O4Purity:98%Color and Shape:SolidMolecular weight:490.0949Perfluorosebacic acid
CAS:Perfluorosebacic acidFormula:C10H2F16O4Purity:95%Color and Shape: white solidMolecular weight:490.09g/molHexadecafluorosebacic Acid
CAS:Formula:C10H2F16O4Purity:>96.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:490.10Hexadecafluorosebacic acid
CAS:Formula:C10H2F16O4Purity:96.0%Color and Shape:Solid, White powderMolecular weight:490.096Perfluorosebacic acid
CAS:Perfluorosebacic acid is a perfluoroalkanedicarboxylic acid, which is useful to prepare synthetic polymers.Formula:C10H2F16O4Purity:98%Color and Shape:White Crystalline PowderMolecular weight:490.09





