CAS 30710-21-5
:2-hydrazino-6-nitro-1,3-benzothiazole
Description:
2-Hydrazino-6-nitro-1,3-benzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole ring fused with a nitro group and a hydrazino functional group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its reactivity, making it a candidate for further chemical modifications. The hydrazino group can participate in various reactions, such as condensation and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which warrants investigation for potential therapeutic uses. Its CAS number, 30710-21-5, allows for easy identification and reference in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as compounds with nitro and hydrazino groups can pose specific hazards. Overall, 2-hydrazino-6-nitro-1,3-benzothiazole is a compound of interest due to its structural features and potential applications in research and industry.
Formula:C7H6N4O2S
InChI:InChI=1/C7H6N4O2S/c8-10-7-9-5-2-1-4(11(12)13)3-6(5)14-7/h1-3H,8H2,(H,9,10)
SMILES:c1cc2c(cc1N(=O)=O)sc(n2)NN
Synonyms:- Benzothiazole, 2-Hydrazinyl-6-Nitro-
- 2-Hydrazino-6-nitro-1,3-benzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Hydrazino-6-nitro-1,3-benzothiazole
CAS:<p>2-Hydrazino-6-nitro-1,3-benzothiazole</p>Molecular weight:210.21g/mol

