CAS 3073-05-0
:Quinquephenyl
Description:
Quinquephenyl, with the CAS number 3073-05-0, is an organic compound characterized by its unique structure, which consists of five phenyl rings connected in a linear arrangement. This polyphenyl compound exhibits notable properties such as high thermal stability and a significant degree of rigidity due to its extended π-conjugated system. Quinquephenyl is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Its molecular structure contributes to interesting electronic properties, making it a subject of study in materials science, particularly in the development of organic semiconductors and light-emitting devices. Additionally, quinquephenyl can exhibit interesting photophysical properties, including fluorescence, which can be harnessed in various applications. The compound's synthesis often involves coupling reactions, and it serves as a building block for more complex organic materials. Overall, quinquephenyl is a significant compound in the field of organic chemistry and materials science, with potential applications in electronics and photonics.
Formula:C30H22
InChI:InChI=1/C30H22/c1-3-7-23(8-4-1)25-11-15-27(16-12-25)29-19-21-30(22-20-29)28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-22H
SMILES:c1ccc(cc1)c1ccc(cc1)c1ccc(cc1)c1ccc(cc1)c1ccccc1
Synonyms:- p-Quinquephenyl
- 1,1':4',1'':4'',1''':4''',1''''-Quinquephenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
p-Quinquephenyl, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C30H22Purity:98%Color and Shape:White, PowderMolecular weight:382.511,1':4',1'':4'',1''':4''',1''''-Quinquephenyl
CAS:Formula:C30H22Purity:97%Color and Shape:SolidMolecular weight:382.4957




