CAS 307327-49-7

{[5-furan-2-yl-4-(2-methylprop-2-en-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetate

Description:

The chemical substance known as {[5-furan-2-yl-4-(2-methylprop-2-en-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetate, with the CAS number 307327-49-7, is characterized by its complex molecular structure that includes a furan ring, a triazole moiety, and a sulfanyl group. This compound exhibits properties typical of heterocyclic compounds, which may include biological activity due to the presence of the triazole ring, known for its role in various pharmacological applications. The furan ring contributes to its aromatic character, potentially influencing its reactivity and interaction with other molecules. The presence of the sulfanyl group suggests potential for nucleophilic behavior, while the acetate moiety may enhance solubility and stability. Overall, this compound may be of interest in medicinal chemistry and agricultural applications, particularly in the development of new therapeutic agents or agrochemicals. Its specific characteristics, such as solubility, melting point, and reactivity, would require empirical investigation to fully understand its behavior in various environments.

Formula: C₁₂H₁₂N₃O₃S

InChI: InChI=1/C12H13N3O3S/c1-8(2)6-15-11(9-4-3-5-18-9)13-14-12(15)19-7-10(16)17/h3-5H,1,6-7H2,2H3,(H,16,17)/p-1

SMILES: C=C(C)Cn1c(c2ccco2)nnc1SCC(=O)[O-]

2-{[5-(Furan-2-yl)-4-(2-methylprop-2-en-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid

CAS: 307327-49-7

Versatile small molecule scaffold

Formula: C₁₂H₁₃N₃O₃S

Purity: Min. 95%

Molecular weight: 279.32 g/mol

Ref: 3D-HMA32749