CAS 307327-55-5

4-ethyl-5-[(3-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

Description:

4-Ethyl-5-[(3-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an ethyl group and a 3-methylphenoxy methyl substituent, contributing to its unique properties and potential applications. The presence of the thiol (-SH) group indicates that it can participate in redox reactions and may act as a reducing agent or a ligand in coordination chemistry. The compound's structure suggests potential biological activity, making it of interest in pharmaceutical and agricultural research, particularly as a fungicide or herbicide. Its solubility and stability in various solvents can vary, influencing its practical applications. As with many triazole derivatives, it may exhibit antifungal properties, which are valuable in crop protection. Safety and handling considerations should be taken into account, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-3-15-11(13-14-12(15)17)8-16-10-6-4-5-9(2)7-10/h4-7H,3,8H2,1-2H3,(H,14,17)

SMILES: CCn1c(COc2cccc(C)c2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-ethyl-5-[(3-methylphenoxy)methyl]-

4-Ethyl-5-[(3-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 307327-55-5

Formula: C₁₂H₁₅N₃OS

Molecular weight: 249.3320

Ref: IN-DA00BD0J

4-Ethyl-5-m-tolyloxymethyl-4H-[1,2,4]triazole-3-thiol

CAS: 307327-55-5

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F057740