CAS 307327-56-6

3,5-Dimethyl-1-pentyl-1H-pyrazole-4-carboxaldehyde oxime

Description:

3,5-Dimethyl-1-pentyl-1H-pyrazole-4-carboxaldehyde oxime, identified by its CAS number 307327-56-6, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxaldehyde functional group and an oxime group, which contribute to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 3 and 5 positions of the pyrazole ring, along with a pentyl chain at the 1 position, influences its physical properties, such as solubility and boiling point. The oxime functional group is known for its ability to form stable complexes with metal ions and can participate in various chemical reactions, including condensation and rearrangement. This compound may be of interest in fields such as medicinal chemistry, agrochemicals, or materials science, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₁₁H₁₉N₃O

InChI: InChI=1S/C11H19N3O/c1-4-5-6-7-14-10(3)11(8-12-15)9(2)13-14/h8,15H,4-7H2,1-3H3

InChI key: InChIKey=QNQUEKCOUCXCDS-UHFFFAOYSA-N

SMILES: C(=NO)C1=C(C)N(CCCCC)N=C1C

Synonyms:

• 3,5-Dimethyl-1-pentyl-1H-pyrazole-4-carboxaldehyde oxime
• 1H-Pyrazole-4-carboxaldehyde, 3,5-dimethyl-1-pentyl-, oxime

N-[(3,5-Dimethyl-1-pentyl-1H-pyrazol-4-yl)methylidene]hydroxylamine

CAS: 307327-56-6

Versatile small molecule scaffold

Formula: C₁₁H₁₉N₃O

Purity: Min. 95%

Molecular weight: 209.29 g/mol

Ref: 3D-HMA32756