CymitQuimica logo

CAS 307339-62-4

:

1,3-dibenzyl-2-(2-methoxyphenyl)imidazolidine

Description:
1,3-Dibenzyl-2-(2-methoxyphenyl)imidazolidine is an organic compound characterized by its imidazolidine core, which features two benzyl groups and a methoxy-substituted phenyl group. This compound typically exhibits a white to off-white crystalline appearance. Its structure suggests potential applications in medicinal chemistry, particularly due to the presence of the imidazolidine ring, which is known for its biological activity. The methoxy group can enhance solubility and influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the presence of multiple aromatic rings may contribute to its stability and hydrophobic characteristics. The compound's molecular interactions, including hydrogen bonding and π-π stacking, could play a significant role in its behavior in various chemical environments. As with many organic compounds, its properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C24H26N2O
InChI:InChI=1/C24H26N2O/c1-27-23-15-9-8-14-22(23)24-25(18-20-10-4-2-5-11-20)16-17-26(24)19-21-12-6-3-7-13-21/h2-15,24H,16-19H2,1H3
Synonyms:
  • Imidazolidine, 2-(2-methoxyphenyl)-1,3-dibenzyl-
  • 1,3-Dibenzyl-2-(2-methoxy-phenyl)-imidazolidine
  • 1,3-Dibenzyl-2-(2-methoxyphenyl)imidazolidin
  • imidazolidine, 2-(2-methoxyphenyl)-1,3-bis(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.