CAS 307343-50-6

ethyl 2-amino-4-(biphenyl-4-yl)thiophene-3-carboxylate

Description:

Ethyl 2-amino-4-(biphenyl-4-yl)thiophene-3-carboxylate, with the CAS number 307343-50-6, is a chemical compound characterized by its unique structure that includes a thiophene ring, an amino group, and an ester functional group. This compound features a biphenyl moiety, which contributes to its potential applications in organic electronics and pharmaceuticals due to its ability to facilitate π-π stacking interactions. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility and reactivity. The ethyl ester group can influence the compound's lipophilicity, making it suitable for various biological applications. Additionally, the thiophene ring is known for its electronic properties, which can be beneficial in the development of materials for organic semiconductors. Overall, this compound's structural characteristics suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and testing.

Formula: C₁₉H₁₇NO₂S

InChI: InChI=1/C19H17NO2S/c1-2-22-19(21)17-16(12-23-18(17)20)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-12H,2,20H2,1H3

SMILES: CCOC(=O)c1c(csc1N)c1ccc(cc1)c1ccccc1

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-4-[1,1'-Biphenyl]-4-Yl-, Ethyl Ester

3-Thiophenecarboxylic acid, 2-amino-4-[1,1'-biphenyl]-4-yl-, ethyl ester

CAS: 307343-50-6

Formula: C₁₉H₁₇NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 323.4088

Ref: IN-DA00313J

Ethyl 2-Amino-4-[1,1'-biphenyl]-4-yl-3-thiophenecarboxylate

CAS: 307343-50-6

Ethyl 2-Amino-4-[1,1'-biphenyl]-4-yl-3-thiophenecarboxylate

Purity: 95%

Molecular weight: 323.41g/mol

Ref: 54-OR1004220

Ethyl 2-amino-4-(1,1'-biphenyl-4-yl)thiophene-3-carboxylate

CAS: 307343-50-6

Purity: 95.0%

Molecular weight: 323.4100036621094

Ref: 10-F364950