CymitQuimica logo

CAS 3074-00-8

:

6H-Benzo[cd]pyren-6-one

Description:
6H-Benzo[cd]pyren-6-one, with the CAS number 3074-00-8, is a polycyclic aromatic ketone that features a fused ring structure characteristic of polycyclic aromatic hydrocarbons (PAHs). This compound is known for its planar structure, which contributes to its potential for intercalating into DNA and its associated biological activities. It typically exhibits a high degree of stability due to its aromatic nature, and it is often studied for its photophysical properties, including fluorescence. The presence of the ketone functional group introduces reactivity that can be exploited in various chemical reactions. Additionally, 6H-Benzo[cd]pyren-6-one is of interest in environmental chemistry due to its potential formation during the incomplete combustion of organic materials, raising concerns about its toxicity and carcinogenicity. Its solubility characteristics can vary, influencing its behavior in different solvents and biological systems. Overall, this compound serves as a significant subject of study in both organic chemistry and environmental science due to its complex properties and implications.
Formula:C19H10O
InChI:InChI=1S/C19H10O/c20-19-14-5-1-3-11-7-9-13-10-8-12-4-2-6-15(19)17(12)18(13)16(11)14/h1-10H
InChI key:InChIKey=CLIKSBRDCNSYNO-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C=5C1=CC=CC5C=CC4=CC=C3C=CC2
Synonyms:
  • Naphthanthrone
  • 6H-BENZO[CD]PYREN-6-ONE
  • 6H-Benzo[cd]pyren-6-one
  • NSC 74892
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.