CAS 3074-46-2
:1-Benzyl-4-phenylpiperazine
Description:
1-Benzyl-4-phenylpiperazine (BZP) is a chemical compound classified as a piperazine derivative. It features a piperazine ring, which is a six-membered saturated heterocyclic compound containing two nitrogen atoms. The structure of BZP includes a benzyl group and a phenyl group attached to the piperazine, contributing to its unique properties. BZP is known for its psychoactive effects and has been studied for its potential as a stimulant. It acts primarily as a serotonin and dopamine receptor agonist, which can lead to increased energy, euphoria, and enhanced sociability. However, it may also have side effects, including anxiety and increased heart rate. BZP is often discussed in the context of recreational use and has been subject to legal regulations in various countries. In terms of physical properties, BZP is typically a white crystalline solid, soluble in organic solvents, and has a relatively low melting point. Its stability and reactivity can vary depending on environmental conditions, making it important to handle it with care in laboratory settings.
Formula:C17H20N2
InChI:InChI=1/C17H20N2/c1-3-7-16(8-4-1)15-18-11-13-19(14-12-18)17-9-5-2-6-10-17/h1-10H,11-15H2
SMILES:c1ccc(cc1)CN1CCN(CC1)c1ccccc1
Synonyms:- Piperazine, 1-phenyl-4-(phenylmethyl)-
- 1-Benzyl-4-phenylpiperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Benzyl-4-phenylpiperazine
CAS:Controlled Product1-Benzyl-4-phenylpiperazine is a type of phenylpiperazine that has hydroxy, phenyl ring, alkylthio, naphthyl and dopamine. It is an agonist for the D2 receptor and a specific ligand for the serotonin 5HT1A receptor. 1-Benzyl-4-phenylpiperazine has been shown to be effective in treating depression and psychotic depression. This drug can also be used as a substance in research on the neuropsychology of depression.Formula:C17H20N2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:252.35 g/mol
