CAS 3074-75-7
:4-Ethyl-2-methylhexane
Description:
4-Ethyl-2-methylhexane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C10H22, indicating it consists of ten carbon atoms and twenty-two hydrogen atoms. This compound features a hexane backbone with an ethyl group at the fourth carbon and a methyl group at the second carbon, contributing to its branched structure. 4-Ethyl-2-methylhexane is typically a colorless liquid at room temperature and is insoluble in water, but it is soluble in organic solvents. It has a relatively high boiling point compared to straight-chain alkanes due to its branched structure, which affects its physical properties, such as volatility and density. This compound is primarily used in research and industrial applications, including as a solvent or in the synthesis of other organic compounds. Its chemical stability and non-polar nature make it suitable for various applications in organic chemistry and materials science. Safety precautions should be taken when handling this substance, as with many hydrocarbons, due to potential flammability and health risks associated with inhalation or skin contact.
Formula:C9H20
InChI:InChI=1S/C9H20/c1-5-9(6-2)7-8(3)4/h8-9H,5-7H2,1-4H3
InChI key:InChIKey=KYCZJIBOPKRSOV-UHFFFAOYSA-N
SMILES:C(CC(C)C)(CC)CC
Synonyms:- Hexane, 4-ethyl-2-methyl-
- 4-Ethyl-2-methylhexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.