CAS 30742-63-3
:2-(4-methylpiperazin-1-yl)-5-nitrobenzaldehyde
Description:
2-(4-Methylpiperazin-1-yl)-5-nitrobenzaldehyde is an organic compound characterized by its functional groups, which include a nitro group (-NO2) and an aldehyde group (-CHO) attached to a benzene ring. The presence of the piperazine moiety, specifically the 4-methylpiperazine, contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. This compound typically exhibits a yellow to orange color due to the nitro group, which can also influence its reactivity and interaction with other chemical species. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The compound's molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard conditions and the presence of both electron-withdrawing and electron-donating groups make it an interesting subject for studies in reactivity and interaction with biological targets.
Formula:C12H15N3O3
InChI:InChI=1/C12H15N3O3/c1-13-4-6-14(7-5-13)12-3-2-11(15(17)18)8-10(12)9-16/h2-3,8-9H,4-7H2,1H3
SMILES:CN1CCN(CC1)c1ccc(cc1C=O)N(=O)=O
Synonyms:- Benzaldehyde, 2-(4-Methyl-1-Piperazinyl)-5-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
