CAS 307496-27-1
:bromo-[(2-bromophenyl)methyl]zinc
Description:
Bromo-[(2-bromophenyl)methyl]zinc, with the CAS number 307496-27-1, is an organozinc compound characterized by the presence of a zinc atom bonded to a bromo-substituted phenyl group. This compound typically exhibits a tetrahedral geometry around the zinc center, which is common for organozinc reagents. It is often used in organic synthesis, particularly in cross-coupling reactions, due to its ability to act as a nucleophile. The presence of bromine in both the phenyl group and as a leaving group enhances its reactivity, making it useful in various transformations, including the formation of carbon-carbon bonds. Bromo-[(2-bromophenyl)methyl]zinc is generally sensitive to moisture and air, requiring careful handling and storage under inert conditions. Its applications are significant in the field of medicinal chemistry and materials science, where it can facilitate the synthesis of complex organic molecules. As with many organometallic compounds, safety precautions should be observed due to potential toxicity and reactivity.
Formula:C7H6Br2Zn
InChI:InChI=1/C7H6Br.BrH.Zn/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6Br2Zn/c8-7-4-2-1-3-6(7)5-10-9/h1-4H,5H2
SMILES:C=C1[CH]C=CC=C1Br.Br.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromobenzylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6Br2ZnMolecular weight:315.31

