CAS 307496-34-0
:bromo-[(3,4-difluorophenyl)methyl]zinc
Description:
Bromo-[(3,4-difluorophenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom bonded to a bromo group and a 3,4-difluorophenylmethyl moiety. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and cross-coupling reactions. The presence of the difluorophenyl group can influence the electronic properties of the compound, potentially enhancing its reactivity and selectivity in chemical reactions. Additionally, the bromo substituent can serve as a leaving group, facilitating nucleophilic substitution reactions. As with many organozinc compounds, it is likely to be sensitive to moisture and air, necessitating careful handling under inert conditions. Overall, bromo-[(3,4-difluorophenyl)methyl]zinc is a valuable reagent in the field of synthetic organic chemistry, particularly in the development of complex molecular architectures.
Formula:C7H5BrF2Zn
InChI:InChI=1/C7H5F2.BrH.Zn/c1-5-2-3-6(8)7(9)4-5;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5BrF2Zn/c8-11-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2
SMILES:C=C1C=CC(C(=C1)F)F.Br.[Zn]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4-Difluorobenzylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrF2ZnMolecular weight:272.43,4-Difluorobenzylzinc bromide 0.5M solution in THF
CAS:3,4-Difluorobenzylzinc bromide 0.5M solution in THFPurity:≥95%Molecular weight:272.42g/mol


