CAS 3075-84-1
:2,2',5,5'-Tetramethylbiphenyl
Description:
2,2',5,5'-Tetramethylbiphenyl, with the CAS number 3075-84-1, is an organic compound belonging to the biphenyl family. It features two phenyl rings connected by a single bond, with four methyl groups attached at the 2 and 5 positions of each ring, contributing to its unique structure and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature, and is known for its relatively high thermal stability and low volatility. It is non-polar, making it soluble in organic solvents but insoluble in water. Due to its bulky structure, 2,2',5,5'-Tetramethylbiphenyl exhibits significant steric hindrance, which can influence its reactivity and interactions with other molecules. It is often used in research and industrial applications, particularly in the field of organic electronics and as a reference material in various analytical techniques. Safety data indicates that it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C16H18
InChI:InChI=1/C16H18/c1-11-5-7-13(3)15(9-11)16-10-12(2)6-8-14(16)4/h5-10H,1-4H3
SMILES:Cc1ccc(C)c(c1)c1cc(C)ccc1C
Synonyms:- 1,1'-Biphenyl, 2,2',5,5'-tetramethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2',5,5'-Tetramethylbiphenyl, 98%
CAS:2,2',5,5'-Tetramethylbiphenyl is used to make other chemicals and as an intermediate in pharmaceuticals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AFormula:C16H18Purity:98%Molecular weight:210.321,1'-Biphenyl, 2,2',5,5'-tetramethyl-
CAS:Formula:C16H18Purity:98%Color and Shape:SolidMolecular weight:210.31412,2′,5,5′-tetramethylbiphenyl
CAS:Formula:C16H18Purity:98%Color and Shape:SolidMolecular weight:210.32


