CAS 307503-19-1
:3-iodoimidazo[1,2-a]pyridine
Description:
3-Iodoimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, with an iodine atom substituted at the 3-position of the imidazole ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the iodine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, 3-iodoimidazo[1,2-a]pyridine may exhibit properties such as fluorescence or photostability, depending on its environment. The compound's unique structural features allow for various synthetic modifications, which can lead to derivatives with altered pharmacological properties. Overall, 3-iodoimidazo[1,2-a]pyridine serves as a valuable scaffold in drug discovery and development, particularly in the search for new therapeutic agents.
Formula:C7H5IN2
InChI:InChI=1/C7H5IN2/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H
SMILES:c1ccn2c(cnc2c1)I
Synonyms:- Imidazo[1,2-a]pyridine, 3-iodo-
- 3-Iodoimidazo[1,2-a]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Imidazo[1,2-a]pyridine, 3-iodo-
CAS:Formula:C7H5IN2Purity:98%Color and Shape:SolidMolecular weight:244.03253-Iodoimidazo[1,2-a]pyridine
CAS:3Iodoimidazo[1,2-a]pyridine is a boronic acid that is used in the synthesis of 3-iodoimidazo[1,2-a]pyridine derivatives. 3Iodoimidazo[1,2-a]pyridine has been found to interact with terminal alkynes in a way similar to the interaction between pyridine and nitrogen. The compound also has a high degree of fluidity and solubility due to its pyridine ring. 3Iodoimidazo[1,2-a]pyridine can be synthesized by chemists using solid phase synthesis or immobilized on a support material. This compound can be used for cross-coupling reactions catalyzed by palladium and heterogeneously with copper or nickel.Formula:C7H5IN2Purity:Min. 95%Molecular weight:244.03 g/mol3-Iodoimidazo[1,2-a]pyridine
CAS:Formula:C7H5IN2Purity:95%Color and Shape:SolidMolecular weight:244.035



