CAS 30752-27-3

1-Bromo-4-(2-phenylethoxy)benzene

Description:

1-Bromo-4-(2-phenylethoxy)benzene, with the CAS number 30752-27-3, is an organic compound characterized by the presence of a bromine atom and a phenylethoxy group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the ether linkage, which connects a phenyl group to the benzene ring through an ethoxy (-O-CH2-CH(C6H5)) moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The phenylethoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems. Its applications could span across fields such as organic synthesis, materials science, and medicinal chemistry, where it may serve as an intermediate or a building block for more complex molecules. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₄H₁₃BrO

InChI: InChI=1S/C14H13BrO/c15-13-6-8-14(9-7-13)16-11-10-12-4-2-1-3-5-12/h1-9H,10-11H2

InChI key: InChIKey=GIPNOEYPGXQTBX-UHFFFAOYSA-N

SMILES: O(CCC1=CC=CC=C1)C2=CC=C(Br)C=C2

1-Bromo-4-(2-phenylethoxy)benzene

CAS: 30752-27-3

Versatile small molecule scaffold

Formula: C₁₄H₁₃BrO

Purity: Min. 95%

Molecular weight: 277.16 g/mol

Ref: 3D-FBA75227