CymitQuimica logo

CAS 307531-79-9

:

(3,4-dimethoxyphenyl)methylzinc chloride

Description:
(3,4-Dimethoxyphenyl)methylzinc chloride is an organozinc compound characterized by the presence of a zinc atom bonded to a methyl group and a 3,4-dimethoxyphenyl group. This compound typically appears as a colorless to light yellow solid or liquid, depending on its form and purity. It is soluble in organic solvents such as diethyl ether and tetrahydrofuran, but generally insoluble in water due to the hydrophobic nature of the organic moiety. The presence of the dimethoxyphenyl group imparts unique reactivity, making it useful in various organic synthesis applications, particularly in the formation of carbon-carbon bonds through nucleophilic substitution reactions. As with many organozinc reagents, it is sensitive to moisture and air, necessitating careful handling under inert atmospheres. Additionally, it may exhibit moderate toxicity, so appropriate safety measures should be taken during its use in laboratory settings. Overall, (3,4-dimethoxyphenyl)methylzinc chloride serves as a valuable reagent in synthetic organic chemistry.
Formula:C9H11ClO2Zn
InChI:InChI=1/C9H11O2.ClH.Zn/c1-7-4-5-8(10-2)9(6-7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11O2Zn.ClH/c1-10-8-4-3-7(6-12)5-9(8)11-2;/h3-5H,6H2,1-2H3;1H/q+1;/p-1
SMILES:C=C1C=CC(C(=C1)OC)OC.Cl.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.