CAS 307531-94-8
:3-[3,5,7,9,11,13,15-heptakis(2-methylpropyl)pentacyclo[9.5.1.1~3,9~.1~5,15~.1~7,13~]octasilox-1-yl]propyl 2-methylprop-2-enoate
Description:
The chemical substance known as "3-[3,5,7,9,11,13,15-heptakis(2-methylpropyl)pentacyclo[9.5.1.1~3,9~.1~5,15~.1~7,13~]octasilox-1-yl]propyl 2-methylprop-2-enoate" with CAS number 307531-94-8 is a complex organic compound characterized by its unique structural features. It contains a pentacyclic siloxane framework, which contributes to its potential applications in materials science, particularly in the development of silicone-based polymers. The presence of multiple 2-methylpropyl groups enhances its hydrophobic properties, making it suitable for use in various formulations, including coatings and sealants. The inclusion of a propyl 2-methylprop-2-enoate moiety suggests that it may also exhibit reactivity typical of unsaturated esters, allowing for further polymerization or cross-linking reactions. Overall, this compound's intricate structure and functional groups indicate its potential utility in advanced materials and chemical applications, although specific properties such as solubility, melting point, and reactivity would require empirical measurement for precise characterization.
Formula:C35H74O14Si8
InChI:InChI=1/C35H74O14Si8/c1-27(2)20-51-38-50(19-17-18-37-35(36)34(15)16)39-52(21-28(3)4)43-54(41-51,23-30(7)8)47-57(26-33(13)14)48-55(42-51,24-31(9)10)44-53(40-50,22-29(5)6)46-56(45-52,49-57)25-32(11)12/h27-33H,15,17-26H2,1-14,16H3
SMILES:CC(C)C[Si]12O[Si]3(CCCOC(=O)C(=C)C)O[Si]4(CC(C)C)O[Si](CC(C)C)(O1)O[Si]1(CC(C)C)O[Si](CC(C)C)(O2)O[Si](CC(C)C)(O3)O[Si](CC(C)C)(O4)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Propenoic acid, 2-methyl-, 3-[3,5,7,9,11,13,15-heptakis(2-methylpropyl)pentacyclo[9.5.1.13,9.15,15.17,13]octasiloxan-1-yl]propyl ester
CAS:Formula:C35H74O14Si8Color and Shape:SolidMolecular weight:943.6377Methacryloxypropylheptaisobutyl-T8-silsesquioxane
CAS:S25227 - Methacryloxypropylheptaisobutyl-T8-silsesquioxane
Formula:C35H74O14Si8Color and Shape:Solid, White solidMolecular weight:943.643Methacryloxypropylheptaisobutyl-T8-silsesquioxane
CAS:Methacryloxypropylheptaisobutyl-T8-silsesquioxane is a monomer in which the polymerization of methacrylate and silsesquioxane can be achieved by using an ionic liquid, such as tetrafluoroborate. The polymerization of methacrylate and silsesquioxane is achieved by using an ionic liquid, such as tetrafluoroborate. The monomer was used to produce coatings in the form of films or beads that are resistant to organic solvents and acids. This monomer has been shown to impart good recoveries for both ethylene and isooctane, with a phase extraction method exhibiting the best morphology.Formula:C35H74O14Si8Purity:Min. 95%Molecular weight:943.6 g/mol



