CAS 307531-97-1

(2,3-Dichlorophenyl)iodozinc

Description:

(2,3-Dichlorophenyl)iodozinc, with the CAS number 307531-97-1, is an organozinc compound characterized by the presence of both iodine and zinc in its molecular structure, along with a dichlorophenyl group. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis. The dichlorophenyl moiety contributes to its chemical behavior, influencing its reactivity and solubility. The presence of iodine can enhance the electrophilic character of the compound, facilitating reactions such as cross-coupling or nucleophilic substitution. Additionally, the zinc atom plays a crucial role in stabilizing the compound and can participate in transmetallation processes. Overall, (2,3-Dichlorophenyl)iodozinc is a valuable reagent in the field of synthetic organic chemistry, particularly in the development of complex molecules and pharmaceuticals. Its specific characteristics, such as stability, solubility, and reactivity, can vary depending on the reaction conditions and the presence of other reagents.

Formula: C₆H₃Cl₂IZn

InChI: InChI=1S/C6H3Cl2.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h1-3H;1H;/q;;+1/p-1

InChI key: InChIKey=VEGMYCYPVNMHQE-UHFFFAOYSA-M

SMILES: [Zn](I)C1=C(Cl)C(Cl)=CC=C1

Synonyms:

• (2,3-Dichlorophenyl)iodozinc
• Zinc, (2,3-dichlorophenyl)iodo-

2,3-Dichlorophenylzinc iodide

CAS: 307531-97-1

Formula: C₆H₃Cl₂IZn

Molecular weight: 338.2785

Ref: IN-DA00316J