CAS 307531-98-2

Chloro[(2-chloro-6-fluorophenyl)methyl]zinc

Description:

Chloro[(2-chloro-6-fluorophenyl)methyl]zinc, with the CAS number 307531-98-2, is an organozinc compound characterized by its coordination of zinc with a chloro-substituted aromatic group. This compound typically exhibits a tetrahedral geometry around the zinc center, which is common for organozinc species. The presence of both chlorine and fluorine substituents on the phenyl ring can influence its reactivity and solubility, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Organometallic compounds like this one are often employed as intermediates in the formation of carbon-carbon bonds, facilitating reactions such as cross-coupling. Additionally, the unique electronic properties imparted by the halogen substituents can enhance the compound's reactivity towards electrophiles. Safety considerations are important when handling this compound, as organozinc reagents can be reactive and potentially hazardous. Proper storage and handling protocols should be followed to ensure safety in laboratory environments.

Formula: C₇H₅Cl₂FZn

InChI: InChI=1S/C7H5ClF.ClH.Zn/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1

InChI key: InChIKey=FJYMMQGYFJMZSE-UHFFFAOYSA-M

SMILES: C([Zn]Cl)C1=C(Cl)C=CC=C1F

Synonyms:

• 2-Chloro-6-fluorobenzylzinc chloride
• Zinc, chloro[(2-chloro-6-fluorophenyl)methyl]-
• Chloro[(2-chloro-6-fluorophenyl)methyl]zinc

2-Chloro-6-fluorobenzylzinc chloride

CAS: 307531-98-2

2-Chloro-6-fluorobenzylzinc chloride

Purity: ≥95%

Molecular weight: 244.43g/mol

Ref: 54-PC1119