CAS 307532-04-3
:(2R)-1-Chloro-3-(4-fluorophenoxy)-2-propanol
Description:
(2R)-1-Chloro-3-(4-fluorophenoxy)-2-propanol is a chemical compound characterized by its chiral center, which imparts specific stereochemical properties. It features a chloro group and a 4-fluorophenoxy moiety, contributing to its potential reactivity and biological activity. The presence of the chloro group suggests that it may participate in nucleophilic substitution reactions, while the fluorophenoxy group can enhance lipophilicity and influence the compound's interaction with biological targets. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. Its solubility in various solvents can vary, influenced by the functional groups present. As a chiral compound, it may exhibit different pharmacological properties based on its stereochemistry, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, (2R)-1-Chloro-3-(4-fluorophenoxy)-2-propanol represents a versatile structure with potential applications in pharmaceuticals and agrochemicals.
Formula:C9H10ClFO2
InChI:InChI=1S/C9H10ClFO2/c10-5-8(12)6-13-9-3-1-7(11)2-4-9/h1-4,8,12H,5-6H2/t8-/m0/s1
InChI key:InChIKey=OSIKOYZBGUHWAB-QMMMGPOBSA-N
SMILES:O(C[C@H](CCl)O)C1=CC=C(F)C=C1
Synonyms:- (2R)-1-Chloro-3-(4-fluorophenoxy)-2-propanol
- (R)-(+)-1-Chloro-3-(4-fluorophenoxy)-2-propanol
- 2-Propanol, 1-chloro-3-(4-fluorophenoxy)-, (2R)-
- 307532-04-3
- (2R)-1-Chloro-3-(4-fluorophenoxy)propan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
