CAS 307538-54-1: 6-bromo-4-(4-methylpiperazin-1-yl)quinazoline
Description:6-Bromo-4-(4-methylpiperazin-1-yl)quinazoline is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. The presence of a bromine atom at the 6-position and a 4-methylpiperazine substituent at the 4-position contributes to its unique properties. This compound is often studied for its potential biological activities, particularly in the field of medicinal chemistry, where it may exhibit pharmacological effects such as antitumor or antimicrobial activity. Its molecular structure allows for interactions with various biological targets, making it a candidate for drug development. Additionally, the piperazine moiety can enhance solubility and bioavailability, which are critical factors in pharmaceutical applications. The compound's stability, reactivity, and interaction with other molecules can be influenced by the bromine substituent and the piperazine ring, making it a subject of interest in synthetic and medicinal chemistry research.
Formula:C13H15BrN4
InChI:InChI=1/C13H15BrN4/c1-17-4-6-18(7-5-17)13-11-8-10(14)2-3-12(11)15-9-16-13/h2-3,8-9H,4-7H2,1H3
- Synonyms:
- Quinazoline, 6-Bromo-4-(4-Methyl-1-Piperazinyl)-
- 6-Bromo-4-(4-methylpiperazin-1-yl)quinazoline
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Quinazoline, 6-bromo-4-(4-methyl-1-piperazinyl)- REF: IN-DA003167CAS: 307538-54-1 | - - - | To inquire | Tue 06 May 25 |
![]() | 6-bromo-4-(4-methylpiperazin-1-yl)quinazoline REF: 10-F314848CAS: 307538-54-1 | 95.0% | To inquire | Wed 14 May 25 |
![]() | 6-Bromo-4-(4-methylpiperazin-1-yl)quinazoline REF: 3D-HMA53854CAS: 307538-54-1 | Min. 95% | - - - | Discontinued product |

Quinazoline, 6-bromo-4-(4-methyl-1-piperazinyl)-
Ref: IN-DA003167
Undefined size | To inquire |

6-bromo-4-(4-methylpiperazin-1-yl)quinazoline
Ref: 10-F314848
250mg | To inquire |

6-Bromo-4-(4-methylpiperazin-1-yl)quinazoline
Ref: 3D-HMA53854
500mg | Discontinued | Request information |