CAS 307551-49-1

4-methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one

Description:

4-Methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one, with the CAS number 307551-49-1, is a synthetic organic compound that belongs to the class of chromones, which are characterized by a benzopyranone structure. This compound features a methyl group and a propoxy substituent, contributing to its unique chemical properties. It typically exhibits a yellow to orange color and is soluble in organic solvents, which is common for many chromone derivatives. The presence of the oxopropoxy group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may also exhibit biological activity, as many chromones are known for their pharmacological properties, including anti-inflammatory and antioxidant effects. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation through experimental studies.

Formula: C₁₇H₁₄O₄

InChI: InChI=1/C17H14O4/c1-10(18)9-20-15-8-7-13-12-5-3-4-6-14(12)17(19)21-16(13)11(15)2/h3-8H,9H2,1-2H3

SMILES: CC(=O)COc1ccc2c3ccccc3c(=O)oc2c1C

4-methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one

CAS: 307551-49-1

Purity: 95.0%

Molecular weight: 282.2950134277344

Ref: 10-F314843