CymitQuimica logo

CAS 30762-02-8

:

Benzoic acid, 4-(cyclopentyloxy)-

Description:
Benzoic acid, 4-(cyclopentyloxy)-, with the CAS number 30762-02-8, is an organic compound characterized by a benzoic acid structure substituted with a cyclopentyloxy group at the para position. This compound typically appears as a white crystalline solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic cyclopentyl moiety. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its unique structure may influence its biological activity and potential applications in pharmaceuticals or as a chemical intermediate. Additionally, the cyclopentyloxy group can affect the compound's lipophilicity and overall reactivity, making it of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H14O3
InChI:InChI=1S/C12H14O3/c13-12(14)9-5-7-11(8-6-9)15-10-3-1-2-4-10/h5-8,10H,1-4H2,(H,13,14)
InChI key:NSTJDFGPPOXIAT-UHFFFAOYSA-N
SMILES:C1CCC(C1)OC2=CC=C(C=C2)C(=O)O
Found 5 products.