CAS 30766-22-4
:Hydroxynicotinicacidmethylester
Description:
Hydroxynicotinic acid methyl ester, identified by its CAS number 30766-22-4, is an organic compound derived from nicotinic acid, which is a form of vitamin B3. This compound features a hydroxyl group and a methyl ester functional group, contributing to its chemical reactivity and potential applications. It typically appears as a white to off-white solid or crystalline substance. Hydroxynicotinic acid methyl ester is known for its role in various chemical reactions, including esterification and as a potential intermediate in the synthesis of pharmaceuticals and agrochemicals. Its solubility characteristics may vary, but it is generally soluble in organic solvents, which makes it useful in organic synthesis. Additionally, the presence of both the hydroxyl and ester groups allows for diverse chemical modifications, enhancing its utility in research and industrial applications. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-11-7(10)5-2-6(9)4-8-3-5/h2-4,9H,1H3
SMILES:COC(=O)c1cc(cnc1)O
Synonyms:- 5-Hydroxynicotinic acid methyl ester
- Methyl 5-Hydroxypyridine-3-Carboxylate
- Methyl 5-hydroxynicotinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Pyridinecarboxylic acid, 5-hydroxy-, methyl ester
CAS:Formula:C7H7NO3Purity:97%Color and Shape:SolidMolecular weight:153.1354Ref: IN-DA00318K
1g22.00€5g25.00€10g41.00€1kgTo inquire25g71.00€5kgTo inquire100g166.00€250g296.00€500g554.00€Methyl 5-Hydroxynicotinate
CAS:Formula:C7H7NO3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:153.14Methyl 5-hydroxynicotinate
CAS:Methyl 5-hydroxynicotinateFormula:C7H7NO3Purity:98%Molecular weight:153.14g/molMethyl 5-hydroxynicotinate
CAS:Formula:C7H7NO3Purity:97%Color and Shape:Solid, PowderMolecular weight:153.137Methyl 5-Hydroxynicotinate
CAS:Controlled ProductApplications Methyl 5-Hydroxynicotinate is an intermediate used to prepare selective cyclooxygenase-2 inhibitors. It is also used to prepare imino sugars as inhibitors of liver glycogen phosphorylase.
References Khanna, I., et al.: J. Med. Chem., 43, 3168 (2000); Jakobsen, P., et al.: Bioorg. Med. Chem., 9, 733 (2001)Formula:C7H7NO3Color and Shape:NeatMolecular weight:153.14





