CAS 30778-27-9
:1-(3,3-diphenylprop-2-en-1-yl)piperidine hydrochloride (1:1)
Description:
1-(3,3-Diphenylprop-2-en-1-yl)piperidine hydrochloride, with the CAS number 30778-27-9, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a substituted alkenyl group, specifically a 3,3-diphenylprop-2-en-1-yl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. The presence of multiple phenyl groups suggests potential for significant π-π stacking interactions, which may influence its biological activity and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile.
Formula:C20H24ClN
InChI:InChI=1/C20H23N.ClH/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21;/h1-2,4-7,10-14H,3,8-9,15-17H2;1H
SMILES:c1ccc(cc1)C(=CCN1CCCCC1)c1ccccc1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1,1-Diphenyl-3-(N-piperidino)prop-1-ene Hydrochloride
CAS:Controlled ProductFormula:C20H23N·ClHColor and Shape:NeatMolecular weight:313.86


