CAS 30781-27-2
:Amadinone
Description:
Amadinone, with the CAS number 30781-27-2, is a synthetic compound that belongs to the class of chemical substances known as phenylpiperidines. It is characterized by its structural features, which typically include a piperidine ring and a phenyl group, contributing to its pharmacological properties. Amadinone is primarily recognized for its potential use in medicinal chemistry, particularly in the development of therapeutic agents. The compound may exhibit various biological activities, including effects on the central nervous system, although specific mechanisms of action and therapeutic applications may vary. Its solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular structure. As with many chemical substances, safety and handling precautions are essential, as they can pose health risks if not managed properly. Further research and characterization are necessary to fully understand its properties and potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C20H25ClO3
InChI:InChI=1S/C20H25ClO3/c1-11(22)20(24)8-6-17-15-10-18(21)16-9-12(23)3-4-13(16)14(15)5-7-19(17,20)2/h9-10,13-15,17,24H,3-8H2,1-2H3/t13-,14-,15-,17+,19+,20+/m1/s1
InChI key:InChIKey=ANJGIFXUFSBZPX-WLCXVKOPSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@@]4(C(C(Cl)=C3)=CC(=O)CC4)[H])(CC1)[H])[H])(CC[C@@]2(C(C)=O)O)[H]
Synonyms:- 19-Norchlormadinone
- 6-Chloro-17-hydroxy-19-norpregna-4,6-diene-3,20-dione
- 6-Chlor-17-hydroxy-19-nor-4,6-pregnadien-3,20-dion
- Amadinone [INN]
- Amadinona
- 6-Chloro-17-hydroxy-19-norpregna-4,6-dione
- 19-Norpregna-4,6-diene-3,20-dione, 6-chloro-17-hydroxy-
- UNII-6MB06022N0
- Amadinonum
- 19-Norpregna-4,6-diene-3,20-dione, 6-chloro-17-hydroxy-
- Amadinona [INN-Spanish]
- Amadinone
- Amadinonum [INN-Latin]
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amadinone
CAS:Amadinone is an androgen antagonist.Formula:C20H25ClO3Color and Shape:SolidMolecular weight:348.86
