
CAS 3079-28-5
:Decyl methyl sulfoxide
Description:
Decyl methyl sulfoxide, with the CAS number 3079-28-5, is an organic compound characterized by its sulfoxide functional group, which features a sulfur atom bonded to an oxygen atom and two carbon-containing groups. This compound typically exhibits a clear to pale yellow liquid form at room temperature and is known for its relatively high polarity, which enhances its solubility in various organic solvents. Decyl methyl sulfoxide is often utilized as a solvent and a reagent in chemical synthesis due to its ability to dissolve a wide range of polar and nonpolar compounds. Additionally, it possesses good thermal stability and low volatility, making it suitable for various industrial applications. Its structure, featuring a decyl chain, contributes to its hydrophobic characteristics, while the methyl sulfoxide group imparts unique chemical reactivity. Safety data sheets indicate that, while it is generally considered to have low toxicity, appropriate handling and safety precautions should be observed to mitigate any potential risks associated with exposure.
Formula:C11H24OS
InChI:InChI=1S/C11H24OS/c1-3-4-5-6-7-8-9-10-11-13(2)12/h3-11H2,1-2H3
InChI key:InChIKey=NZJXADCEESMBPW-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCCS(C)=O
Synonyms:- Decane, 1-(methylsulfinyl)-
- 1-(Methylsulfinyl)decane
- Sulfoxide, decyl methyl
- Decyl methyl sulfoxide
- n-Decyl methyl sulfoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Decyl methyl sulfoxide
CAS:1-Decyl methyl sulfoxide is a biochemical.Formula:C11H24OSColor and Shape:SolidMolecular weight:204.37

