CAS 308-95-2
:1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-bis(pentafluoroethyl)cyclohexanamine
Description:
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-bis(pentafluoroethyl)cyclohexanamine, with CAS number 308-95-2, is a fluorinated organic compound characterized by its complex structure featuring multiple fluorine atoms attached to a cyclohexane ring. This compound exhibits high thermal and chemical stability due to the presence of fluorine, which enhances its resistance to degradation. Its unique properties make it hydrophobic and lipophobic, contributing to its potential applications in various fields, including specialty coatings, surfactants, and as a potential intermediate in the synthesis of other fluorinated compounds. The presence of the amine functional group suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the extensive fluorination imparts low surface energy, making it useful in applications requiring non-stick or water-repellent surfaces. However, the environmental and health impacts of such highly fluorinated compounds are subjects of ongoing research, particularly concerning their persistence and bioaccumulation in ecosystems.
Formula:C10F21N
InChI:InChI=1/C10F21N/c11-1(12)2(13,14)4(17,18)6(21,5(19,20)3(1,15)16)32(9(28,29)7(22,23)24)10(30,31)8(25,26)27
SMILES:C1(C(C(C(C(C1(F)F)(F)F)(F)N(C(C(F)(F)F)(F)F)C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- Cyclohexanamine, 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-bis(pentafluoroethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2,2,3,3,4,4,5,5,6,6-Undecafluoro-N,N-Bis(1,1,2,2,2-Pentafluoroethyl)Cyclohexan-1-Amine
CAS:Controlled Product<p>1,2,2,3,3,4,4,5,5,6,6-Undecafluoro-N,N-Bis(1,1,2,2,2-Pentafluoroethyl)Cyclohexan-1-Amine is an efficient mitochondrial respiratory uncoupler that has been shown to increase the rate of oxidative phosphorylation in rat liver. It is also a membrane permeable compound that can be incorporated into micelles. This drug has been shown to have suboptimal effects on morphology and mitochondrial function in mice. 1,2 2 3 3 4 4 5 5 6 6 -Undecafluoro-N N Bis (1 1 2 2 2 2 Pentafluoroethyl) Cyclohexan 1 Amine has potential applications as a therapeutic agent for patients with respiratory disorders such as cystic fibrosis or chronic obstructive pulmonary disease.</p>Formula:C10F21NPurity:Min. 95%Molecular weight:533.08 g/mol
