
CAS 3080-69-1
:2-Hexyl-4-methyl-1,3-dioxane
Description:
2-Hexyl-4-methyl-1,3-dioxane is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is typically colorless to pale yellow and has a distinctive odor. It is classified as a cyclic ether and is known for its relatively low polarity due to the presence of hydrocarbon chains, which can influence its solubility in various solvents. The presence of hexyl and methyl groups contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 2-Hexyl-4-methyl-1,3-dioxane may exhibit moderate volatility and can be flammable under certain conditions. Its applications can range from use as a solvent in chemical reactions to potential roles in the synthesis of other organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health and environmental impacts.
Formula:C11H22O2
InChI:InChI=1S/C11H22O2/c1-3-4-5-6-7-11-12-9-8-10(2)13-11/h10-11H,3-9H2,1-2H3
InChI key:InChIKey=WHAXQUXICKDLJD-UHFFFAOYSA-N
SMILES:C(CCCCC)C1OC(C)CCO1
Synonyms:- 2-Hexyl-4-methyl-1,3-dioxane
- NSC 6838
- Heptanal, cyclic 1-methyltrimethylene acetal
- 1,3-Dioxane, 2-hexyl-4-methyl-
- m-Dioxane, 2-hexyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dioxane, 2-hexyl-4-methyl-
CAS:1,3-Dioxane, 2-hexyl-4-methyl- is a bioactive chemical.Formula:C11H22O2Color and Shape:SolidMolecular weight:186.29
