CAS 3081-67-2
:1-(2,3-dimethoxyphenyl)propan-2-one
Description:
1-(2,3-Dimethoxyphenyl)propan-2-one, with the CAS number 3081-67-2, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a propan-2-one backbone, which is a three-carbon chain with a carbonyl group (C=O) at the second carbon. The presence of the 2,3-dimethoxyphenyl group indicates that the aromatic ring has two methoxy (-OCH3) substituents located at the second and third positions, enhancing its electron-donating properties. This structure contributes to its potential reactivity and solubility in organic solvents. The compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and organic synthesis. Additionally, its physical properties, such as boiling point and melting point, would depend on the molecular interactions and the presence of functional groups. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-8(12)7-9-5-4-6-10(13-2)11(9)14-3/h4-6H,7H2,1-3H3
SMILES:CC(=O)Cc1cccc(c1OC)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2,3-Dimethoxyphenyl)acetone
CAS:2,3-Dimethoxyphenylacetone is a synthetic compound that has been used as a precursor to other compounds. The synthesis of 2,3-dimethoxyphenylacetone requires the reaction of lithium aluminum hydride with acrylonitrile and hydriodic acid. The molecule can be cyclized in two different ways to form either 2,3-dimethoxybenzaldehyde or 3-methoxybenzaldehyde. The structure of 2,3-dimethoxyphenylacetone is similar to that of hydrazoic acid which has been used as an intermediate in the synthesis of other compounds such as pyrazines.
Formula:C11H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:194.23 g/mol

