CAS 308103-40-4
:2-Acetylphenylboronic acid
Description:
2-Acetylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains an acetyl substituent. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its structure features a boron atom bonded to a phenyl group and a hydroxyl group, which imparts acidic properties. The acetyl group enhances its reactivity, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in organic synthesis. Additionally, 2-acetylphenylboronic acid can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. Its reactivity and functional versatility make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Proper handling and storage are essential, as with many boronic acids, to maintain stability and prevent degradation.
Formula:C8H9BO3
InChI:InChI=1S/C8H9BO3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5,11-12H,1H3
InChI key:InChIKey=ZKAOVABYLXQUTI-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C(C)=O)C=CC=C1
Synonyms:- B-(2-Acetylphenyl)boronic acid
- Boronic acid, (2-acetylphenyl)-
- 2-Acetylphenylboronic acid
- 2-Acetylbenzeneboronic acid
- Boronic acid, B-(2-acetylphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Acetylbenzeneboronic acid, 97%
CAS:<p>2-Acetylphenylboronic acid is a reactant used for a variety of coupling reactions, as well as synthesis and hydroxy masking, Suzuki-Miyaura cross-coupling reactions, rhodium-catalyzed annulation of ynamides, transient masking of hydroxy groups, cationic palladium complex-catalyzed diastereoselective</p>Formula:C8H9BO3Purity:97%Color and Shape:White to yellow, Powder and/or chunksMolecular weight:163.97Boronic acid, B-(2-acetylphenyl)-
CAS:Formula:C8H9BO3Purity:96%Color and Shape:SolidMolecular weight:163.96632-Acetylbenzeneboronic acid
CAS:2-Acetylbenzeneboronic acidFormula:C8H9BO3Purity:95%Color and Shape: faint beige solidMolecular weight:163.96626g/mol2-Acetylphenylboronic Acid
CAS:Controlled Product<p>Applications 2-Acetylphenylboronic Acid is a reactant used in the synthesis of potent, selective phenylimidazole-based tissue factor/factor VIIa (FVIIa) inhibitors.<br>References Glunz, P.W., et. al.: Bioorg. Med. Chem. Lett., 25, 21699 (2015)<br></p>Formula:C8H9BO3Color and Shape:NeatMolecular weight:163.97





