CAS 30811-69-9
:Poly(vinyl acrylate)
Description:
Poly(vinyl acrylate) (PVA) is a synthetic polymer derived from the polymerization of vinyl acrylate monomers. It is characterized by its excellent adhesion properties, flexibility, and resistance to water and various chemicals, making it suitable for a wide range of applications, including adhesives, coatings, and sealants. PVA exhibits good thermal stability and can be processed into films or emulsions. Its mechanical properties can vary depending on the molecular weight and degree of polymerization, allowing for customization based on specific application needs. Additionally, PVA is known for its low toxicity and biocompatibility, which makes it a favorable choice in medical and cosmetic formulations. The polymer can also be modified to enhance its properties, such as increasing its hydrophilicity or improving its compatibility with other materials. Overall, poly(vinyl acrylate) is a versatile polymer with significant industrial relevance due to its unique combination of physical and chemical properties.
Formula:(C5H6O2)x
InChI:InChI=1S/C5H6O2/c1-3-5(6)7-4-2/h3-4H,1-2H2
InChI key:InChIKey=BLCTWBJQROOONQ-UHFFFAOYSA-N
SMILES:C(OC=C)(C=C)=O
Synonyms:- Acrylic acid, vinyl ester, polymers
- Vinyl acrylate homopolymer
- Vinyl acrylate polymer
- 2-Propenoic acid, ethenyl ester, homopolymer
- Poly(vinyl acrylate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
